CAS 1177093-01-4

Imidazo[2,1-b]thiazole-2-carboxylic acid, 6-phenyl-, ethyl ester, hydrobromide (1:1)

Description:

Imidazo[2,1-b]thiazole-2-carboxylic acid, 6-phenyl-, ethyl ester, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the ethyl ester group suggests it may have moderate lipophilicity, influencing its solubility and permeability in biological systems. The hydrobromide salt form indicates that it is likely more stable and soluble in aqueous environments, which is advantageous for pharmaceutical applications. Additionally, the phenyl group can enhance the compound's interaction with biological targets, potentially leading to varied pharmacological effects. As with many compounds containing nitrogen and sulfur, it may exhibit interesting reactivity and can participate in various chemical transformations. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents.

Formula: C₁₄H₁₂N₂O₂S·BrH

InChI: InChI=1S/C14H12N2O2S.BrH/c1-2-18-13(17)12-9-16-8-11(15-14(16)19-12)10-6-4-3-5-7-10;/h3-9H,2H2,1H3;1H

InChI key: InChIKey=QXSONYQHYXZVFD-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC=2N(C=C(N2)C3=CC=CC=C3)C1.Br

Synonyms:

• Imidazo[2,1-b]thiazole-2-carboxylic acid, 6-phenyl-, ethyl ester, hydrobromide (1:1)