CAS 1177093-08-1

Pyrimidine, 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-(1-piperazinyl)-, hydrochloride (1:2)

Description:

Pyrimidine, 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-(1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyrimidine ring, a cyclopropyl group, and a piperazine moiety. The presence of the 1,2,4-oxadiazole ring contributes to its potential biological activity, as oxadiazoles are often associated with various pharmacological properties. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions, making it suitable for biological studies. The piperazine group is known for its role in enhancing the pharmacokinetic properties of compounds, potentially improving their efficacy and safety profiles. The specific arrangement of substituents on the pyrimidine and oxadiazole rings may influence the compound's interactions with biological targets, making it of interest in medicinal chemistry and drug development. As with many such compounds, further research is necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic applications.

Formula: C₁₃H₁₆N₆O·2ClH

InChI: InChI=1S/C13H16N6O.2ClH/c1-2-9(1)12-17-11(18-20-12)10-3-4-15-13(16-10)19-7-5-14-6-8-19;;/h3-4,9,14H,1-2,5-8H2;2*1H

InChI key: InChIKey=CRAPLOFTRBVTAN-UHFFFAOYSA-N

SMILES: C=1(N=C(ON1)C2CC2)C3=NC(=NC=C3)N4CCNCC4.Cl

Synonyms:

• Pyrimidine, 4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-2-(1-piperazinyl)-, hydrochloride (1:2)