CymitQuimica logo

CAS 1177093-10-5

:

Pyrimidine, 4-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(1-piperazinyl)-, hydrochloride (1:2)

Description:
Pyrimidine, 4-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with a 5-methyl-1,2,4-oxadiazole moiety and a piperazine group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. The piperazine group is often associated with various therapeutic effects, including anxiolytic and antidepressant activities. The compound's molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic nature of the pyrimidine and oxadiazole rings. Its specific applications can vary, but it may be explored in medicinal chemistry for developing new pharmaceuticals. As with many synthetic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C11H14N6O·2ClH
InChI:InChI=1S/C11H14N6O.2ClH/c1-8-14-10(16-18-8)9-2-3-13-11(15-9)17-6-4-12-5-7-17;;/h2-3,12H,4-7H2,1H3;2*1H
InChI key:InChIKey=WKVMPUXKJVXMPD-UHFFFAOYSA-N
SMILES:CC1=NC(C2=NC(=NC=C2)N3CCNCC3)=NO1.Cl
Synonyms:
  • Pyrimidine, 4-(5-methyl-1,2,4-oxadiazol-3-yl)-2-(1-piperazinyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.