CymitQuimica logo

CAS 1177093-11-6

:

Pyrimidine, 4-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]-2-(1-piperazinyl)-, hydrochloride (1:2)

Description:
Pyrimidine, 4-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]-2-(1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyrimidine ring, an oxadiazole moiety, and a piperazine substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the methoxymethyl group may enhance its solubility and stability, while the hydrochloride form indicates that it is a salt, which can influence its pharmacokinetic properties, such as absorption and bioavailability. The compound's molecular interactions may be significant for its activity, particularly in relation to its potential as a pharmaceutical agent. Additionally, the piperazine ring is often associated with various pharmacological effects, including anxiolytic and antipsychotic properties. Overall, this compound's unique structural features suggest it may have applications in drug development, particularly in targeting specific biological pathways.
Formula:C12H16N6O2·2ClH
InChI:InChI=1S/C12H16N6O2.2ClH/c1-19-8-10-16-11(17-20-10)9-2-3-14-12(15-9)18-6-4-13-5-7-18;;/h2-3,13H,4-8H2,1H3;2*1H
InChI key:InChIKey=PGHCYJAEMDSFJF-UHFFFAOYSA-N
SMILES:C(OC)C1=NC(C2=NC(=NC=C2)N3CCNCC3)=NO1.Cl
Synonyms:
  • Pyrimidine, 4-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]-2-(1-piperazinyl)-, hydrochloride (1:2)
Found 1 products.