CymitQuimica logo

CAS 1177093-12-7

:

3-[2-[(4-Chlorophenyl)methoxy]phenyl]-1H-pyrazole

Description:
3-[2-[(4-Chlorophenyl)methoxy]phenyl]-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group substituted with a methoxy group and a 4-chlorophenyl moiety, contributing to its structural complexity and potential biological activity. The presence of the chlorophenyl group may enhance lipophilicity, influencing its interaction with biological targets. The methoxy group can also affect the compound's solubility and reactivity. This substance is often studied for its potential pharmacological properties, including anti-inflammatory or analgesic effects, due to the presence of the pyrazole ring, which is known for its diverse biological activities. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C16H13ClN2O
InChI:InChI=1S/C16H13ClN2O/c17-13-7-5-12(6-8-13)11-20-16-4-2-1-3-14(16)15-9-10-18-19-15/h1-10H,11H2,(H,18,19)
InChI key:InChIKey=HYOPPZBEBKTALU-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(Cl)C=C1)C2=C(C=CC=C2)C=3C=CNN3
Synonyms:
  • 1H-Pyrazole, 3-[2-[(4-chlorophenyl)methoxy]phenyl]-
  • 3-[2-[(4-Chlorophenyl)methoxy]phenyl]-1H-pyrazole
  • 3-{2-[(4-chlorobenzyl)oxy]phenyl}-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.