CymitQuimica logo

CAS 1177093-13-8

:

1-Piperazineethanol, 4-[(4-chlorophenyl)phenylmethyl]-, hydrochloride (1:1)

Description:
1-Piperazineethanol, 4-[(4-chlorophenyl)phenylmethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperazine and phenylmethyl moieties, which contribute to its potential biological activity. The presence of the 4-chlorophenyl group suggests that it may exhibit specific interactions with biological targets, possibly influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit properties such as being a potential anxiolytic or antidepressant, although specific biological activities would depend on further empirical studies. Its molecular structure includes a piperazine ring, which is known for its role in various drug formulations, and the hydroxyl group from the ethanol component may contribute to hydrogen bonding interactions. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Further research is necessary to fully elucidate its pharmacodynamics and pharmacokinetics.
Formula:C19H23ClN2O·ClH
InChI:InChI=1S/C19H23ClN2O.ClH/c20-18-8-6-17(7-9-18)19(16-4-2-1-3-5-16)22-12-10-21(11-13-22)14-15-23;/h1-9,19,23H,10-15H2;1H
InChI key:InChIKey=QHOUBOTWXPYCOW-UHFFFAOYSA-N
SMILES:C(N1CCN(CCO)CC1)(C2=CC=C(Cl)C=C2)C3=CC=CC=C3.Cl
Synonyms:
  • 1-Piperazineethanol, 4-[(4-chlorophenyl)phenylmethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.