CAS 1177093-21-8

Piperazine, 1-[5-(2-methyl-1H-imidazol-1-yl)-2-nitrophenyl]-, hydrochloride (1:2)

Description:

Piperazine, 1-[5-(2-methyl-1H-imidazol-1-yl)-2-nitrophenyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a nitrophenyl group and a 2-methyl-1H-imidazole moiety, contributing to its unique properties and potential biological activity. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is often desirable for pharmacological applications. The presence of the nitro group suggests potential reactivity and may influence its interaction with biological targets. Piperazine derivatives are known for their diverse pharmacological activities, including anxiolytic, antidepressant, and antimicrobial effects. The specific arrangement of substituents in this compound may also impart unique characteristics, such as altered lipophilicity and binding affinity to various receptors. As with many chemical substances, safety and handling precautions are essential, particularly due to the potential toxicity associated with nitro compounds. Further studies would be necessary to fully elucidate its biological properties and therapeutic potential.

Formula: C₁₄H₁₇N₅O₂·2ClH

InChI: InChI=1S/C14H17N5O2.2ClH/c1-11-16-6-9-18(11)12-2-3-13(19(20)21)14(10-12)17-7-4-15-5-8-17;;/h2-3,6,9-10,15H,4-5,7-8H2,1H3;2*1H

InChI key: InChIKey=BAMDRYSKOXPVQN-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=C(C=C1)N2C(C)=NC=C2)N3CCNCC3.Cl

Synonyms:

• Piperazine, 1-[5-(2-methyl-1H-imidazol-1-yl)-2-nitrophenyl]-, hydrochloride (1:2)

1-(5-(2-Methyl-1H-imidazol-1-yl)-2-nitrophenyl)piperazine dihydrochloride

CAS: 1177093-21-8

Formula: C₁₄H₁₉Cl₂N₅O₂

Molecular weight: 360.24

Ref: 10-F095610