CAS 1177093-22-9

1-Piperazineethanol, 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-, hydrochloride (1:1)

Description:

1-Piperazineethanol, 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperazine and triazine moieties, which contribute to its potential biological activity. The presence of the piperazine ring suggests properties related to neurotransmitter modulation, while the triazine structure may impart herbicidal or antimicrobial properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit a range of pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure indicates the potential for hydrogen bonding due to the hydroxyl group, which can influence its interaction with biological targets. Additionally, the dimethoxy substituents on the triazine ring may affect its electronic properties and reactivity. Overall, this compound's unique structural features suggest it could be valuable in various research and therapeutic contexts, although specific biological activities and mechanisms would require further investigation.

Formula: C₁₁H₁₉N₅O₃·ClH

InChI: InChI=1S/C11H19N5O3.ClH/c1-18-10-12-9(13-11(14-10)19-2)16-5-3-15(4-6-16)7-8-17;/h17H,3-8H2,1-2H3;1H

InChI key: InChIKey=KEXLFWKQRLPSEL-UHFFFAOYSA-N

SMILES: O(C)C1=NC(=NC(OC)=N1)N2CCN(CCO)CC2.Cl

Synonyms:

• 1-Piperazineethanol, 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-, hydrochloride (1:1)