CymitQuimica logo

CAS 117711-60-1

:

1-bromodifluoromethyl-1-cyclohexane

Description:
1-Bromodifluoromethyl-1-cyclohexane is a chemical compound characterized by the presence of a bromine atom and two fluorine atoms attached to a cyclohexane ring. This compound features a difluoromethyl group, which contributes to its unique reactivity and physical properties. The presence of halogens, particularly bromine and fluorine, often enhances the compound's lipophilicity and can influence its boiling and melting points compared to non-halogenated analogs. The cyclohexane ring provides a stable, saturated hydrocarbon framework, which can affect the compound's conformational flexibility and steric interactions. Additionally, the presence of electronegative halogens can impact the compound's polarity and potential for hydrogen bonding, making it of interest in various chemical applications, including synthesis and material science. Its specific reactivity and applications would depend on the context of its use, such as in pharmaceuticals or agrochemicals, where halogenated compounds often play significant roles. Safety and handling precautions are essential due to the potential hazards associated with halogenated organic compounds.
Formula:C6H14ClFN2O2
InChI:InChI=1/C6H13FN2O2.ClH/c7-4(3-8)1-2-5(9)6(10)11;/h4-5H,1-3,8-9H2,(H,10,11);1H
SMILES:C(CC(C(=O)O)N)C(CN)F.Cl
Synonyms:
  • 1-Bromodifluoromethyl-1-cyclohexene
  • 1-[Bromo(Difluoro)Methyl]Cyclohexene
  • 6-Ammonio-5-Fluoronorleucine Chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.