CymitQuimica logo

CAS 117713-49-2

:

7-Chloro-6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine

Description:
7-Chloro-6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a chlorine atom at the 7-position, an ethyl group at the 6-position, and a methyl group at the 5-position of the triazolo-pyrimidine framework. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogen and alkyl substituents can influence the compound's solubility, reactivity, and interaction with biological targets. Additionally, the compound's triazole moiety may exhibit properties such as antifungal or antimicrobial activity, while the pyrimidine component can be associated with nucleic acid interactions. Overall, 7-Chloro-6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C8H9ClN4
InChI:InChI=1S/C8H9ClN4/c1-3-6-5(2)12-8-10-4-11-13(8)7(6)9/h4H,3H2,1-2H3
InChI key:InChIKey=TWMIAIOQGKGLKF-UHFFFAOYSA-N
SMILES:ClC=1N2C(N=C(C)C1CC)=NC=N2
Synonyms:
  • [1,2,4]Triazolo[1,5-a]pyrimidine, 7-chloro-6-ethyl-5-methyl-
  • 7-Chloro-6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine
  • s-Triazolo[1,5-a]pyrimidine, 7-chloro-6-ethyl-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.