CAS 117718-86-2

6-Bromo-8-(ethylamino)imidazo[1,2-a]pyrazine

Description:

6-Bromo-8-(ethylamino)imidazo[1,2-a]pyrazine is a heterocyclic compound characterized by its imidazo[1,2-a]pyrazine core, which consists of fused imidazole and pyrazine rings. The presence of a bromine atom at the 6-position and an ethylamino group at the 8-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The bromine substituent can enhance reactivity and facilitate further chemical modifications, while the ethylamino group may influence its pharmacokinetic properties. As with many heterocycles, it may exhibit diverse biological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.

Formula: C₈H₉BrN₄

InChI: InChI=1S/C8H9BrN4/c1-2-10-7-8-11-3-4-13(8)5-6(9)12-7/h3-5H,2H2,1H3,(H,10,12)

InChI key: InChIKey=STIRLFBTSNDDBZ-UHFFFAOYSA-N

SMILES: N(CC)C=1C=2N(C=C(Br)N1)C=CN2

Synonyms:

• Imidazo[1,2-a]pyrazin-8-amine, 6-bromo-N-ethyl-
• 6-Bromo-8-(ethylamino)imidazo[1,2-a]pyrazine
• 6-Bromo-N-ethylimidazo[1,2-a]pyrazin-8-amine
• PAB 15