CAS 117718-88-4: Imidazo[1,2-a]pyrazin-8-amine (9CI)
Description:Imidazo[1,2-a]pyrazin-8-amine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. This compound features an amino group at the 8-position of the pyrazine ring, enhancing its reactivity and potential for forming hydrogen bonds. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Imidazo[1,2-a]pyrazin-8-amine is of interest in medicinal chemistry, particularly for its potential biological activities, including antimicrobial and anticancer properties. The compound's structure allows for various modifications, which can lead to derivatives with enhanced pharmacological profiles. Additionally, its molecular framework is conducive to interactions with biological targets, making it a candidate for drug development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C6H6N4
InChI:InChI=1S/C6H6N4/c7-5-6-9-2-4-10(6)3-1-8-5/h1-4H,(H2,7,8)
InChI key:InChIKey=RZLXZEJRGRNLQR-UHFFFAOYSA-N
SMILES:N=1C=CN2C=CN=C2C1N

Imidazo[1,2-a]pyrazin-8-amine
Ref: IN-DA0077H9
1g | 543.00 € | ||
5g | To inquire | ||
100mg | 189.00 € | ||
250mg | 228.00 € |

Ref: 54-OR85839
1g | 972.00 € | ||
100mg | 286.00 € | ||
250mg | 462.00 € |

Ref: 10-F602871
1g | 625.00 € | ||
100mg | 156.00 € | ||
250mg | 250.00 € |

Imidazo[1,2-a]pyrazin-8-amine
Ref: 3D-SEA71888
1g | 1,050.00 € | ||
100mg | 478.00 € |