CAS 117719-10-5
:2-AMINO-5-BROMO-3-(ETHYLAMINO)PYRAZINE
Description:
2-Amino-5-bromo-3-(ethylamino)pyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group and an ethylamino substituent, contributing to its basicity and potential reactivity. The presence of a bromine atom at the 5-position enhances its electrophilic character, making it suitable for various chemical reactions, including nucleophilic substitutions. The molecular structure suggests that it may exhibit biological activity, possibly as a pharmaceutical intermediate or in agrochemical applications. Its solubility properties are influenced by the amino groups, which can engage in hydrogen bonding, affecting its interaction with solvents. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and amino groups. Overall, 2-amino-5-bromo-3-(ethylamino)pyrazine is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C6H9BrN4
InChI:InChI=1/C6H9BrN4/c1-2-9-6-5(8)10-3-4(7)11-6/h3H,2H2,1H3,(H2,8,10)(H,9,11)
SMILES:CCNc1c(N)ncc(Br)n1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
