CAS 117723-13-4
:7-Methylguanosine 5′-(trihydrogen diphosphate)
Description:
7-Methylguanosine 5′-(trihydrogen diphosphate), commonly referred to as 7-methyl-GDP, is a modified nucleotide that plays a significant role in various biochemical processes, particularly in RNA metabolism and signaling pathways. This compound features a guanine base that is methylated at the N7 position, which is crucial for its biological function, including its involvement in the capping of mRNA molecules. The presence of the diphosphate group indicates that it is a nucleotide derivative, which is essential for energy transfer and signaling in cellular processes. The trihydrogen aspect refers to the protonation state of the diphosphate group, influencing its reactivity and interaction with other biomolecules. 7-Methylguanosine 5′-(trihydrogen diphosphate) is often studied in the context of its role in post-transcriptional modifications and its impact on the stability and translation of RNA. Its unique structural features contribute to its function in cellular signaling and regulation, making it an important subject of research in molecular biology and biochemistry.
Formula:C11H18N5O11P2
InChI:InChI=1S/C11H17N5O11P2/c1-15-3-16(8-5(15)9(19)14-11(12)13-8)10-7(18)6(17)4(26-10)2-25-29(23,24)27-28(20,21)22/h3-4,6-7,10,17-18H,2H2,1H3,(H5-,12,13,14,19,20,21,22,23,24)/p+1/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=SBASPRRECYVBRF-KQYNXXCUSA-O
SMILES:C[N+]=1C2=C(N(C1)[C@@H]3O[C@H](COP(OP(=O)(O)O)(=O)O)[C@@H](O)[C@H]3O)NC(N)=NC2=O
Synonyms:- 7-Methylguanosine 5′-diphosphate
- 1H-Purinium, 2-amino-6,9-dihydro-9-[5-O-[hydroxy(phosphonooxy)phosphinyl]-β-D-ribofuranosyl]-7-methyl-6-oxo-
- 7-Methylguanosine 5′-(trihydrogen diphosphate)
- 7-Methyl-GDP
- Guanosine 5′-(trihydrogen diphosphate), 7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
