CymitQuimica logo

CAS 1177269-08-7

:

5-(1-Methyl-1H-imidazol-5-yl)-2-pyridinamine

Description:
5-(1-Methyl-1H-imidazol-5-yl)-2-pyridinamine, identified by its CAS number 1177269-08-7, is a chemical compound characterized by its unique structural features that include a pyridine ring and an imidazole moiety. This compound typically exhibits properties associated with both heterocyclic aromatic systems, which can influence its reactivity and interaction with biological targets. The presence of the amino group (-NH2) on the pyridine ring suggests potential for hydrogen bonding and participation in various chemical reactions, making it a candidate for applications in medicinal chemistry and drug development. Additionally, the methyl group on the imidazole ring can affect the compound's lipophilicity and solubility, which are critical factors in pharmacokinetics. Overall, this compound's structural characteristics may confer specific biological activities, making it of interest in research related to pharmaceuticals or agrochemicals. Further studies would be necessary to elucidate its precise biological functions and potential applications.
Formula:C9H10N4
InChI:InChI=1S/C9H10N4/c1-13-6-11-5-8(13)7-2-3-9(10)12-4-7/h2-6H,1H3,(H2,10,12)
InChI key:InChIKey=VRLDNDUQXQYPLZ-UHFFFAOYSA-N
SMILES:CN1C(=CN=C1)C=2C=CC(N)=NC2
Synonyms:
  • 2-Pyridinamine, 5-(1-methyl-1H-imidazol-5-yl)-
  • 5-(1-Methyl-1H-imidazol-5-yl)-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.