CymitQuimica logo

CAS 1177269-10-1

:

5-(5-Methyl-1,3,4-thiadiazol-2-yl)-2-pyridinamine

Description:
5-(5-Methyl-1,3,4-thiadiazol-2-yl)-2-pyridinamine is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thiadiazole moiety. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound's molecular structure suggests it may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological data would be necessary to confirm these effects. Additionally, the methyl group on the thiadiazole enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound's CAS number, 1177269-10-1, allows for precise identification and retrieval of information in chemical databases. Overall, this compound represents a class of heterocyclic compounds that may have applications in medicinal chemistry and drug development, warranting further investigation into its properties and potential uses.
Formula:C8H8N4S
InChI:InChI=1S/C8H8N4S/c1-5-11-12-8(13-5)6-2-3-7(9)10-4-6/h2-4H,1H3,(H2,9,10)
InChI key:InChIKey=FTOXUFKMUWSZAA-UHFFFAOYSA-N
SMILES:CC=1SC(C=2C=CC(N)=NC2)=NN1
Synonyms:
  • 2-Pyridinamine, 5-(5-methyl-1,3,4-thiadiazol-2-yl)-
  • 5-(5-Methyl-1,3,4-thiadiazol-2-yl)-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.