CymitQuimica logo

CAS 1177274-26-8

:

4-(1,1-Dimethylethyl)-N-(3-pyridinylmethyl)-2-benzothiazolamine

Description:
4-(1,1-Dimethylethyl)-N-(3-pyridinylmethyl)-2-benzothiazolamine, identified by its CAS number 1177274-26-8, is a chemical compound characterized by its complex structure, which includes a benzothiazole moiety and a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the dimethyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The benzothiazole and pyridine components suggest potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, which could be relevant in synthetic applications or as a pharmacophore in drug development. Overall, its unique structural features position it as a candidate for further investigation in various chemical and pharmaceutical contexts.
Formula:C17H19N3S
InChI:InChI=1S/C17H19N3S/c1-17(2,3)13-7-4-8-14-15(13)20-16(21-14)19-11-12-6-5-9-18-10-12/h4-10H,11H2,1-3H3,(H,19,20)
InChI key:InChIKey=MSEJXLLPPPUFBN-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C2C(SC(NCC=3C=CC=NC3)=N2)=CC=C1
Synonyms:
  • 4-(1,1-Dimethylethyl)-N-(3-pyridinylmethyl)-2-benzothiazolamine
  • 2-Benzothiazolamine, 4-(1,1-dimethylethyl)-N-(3-pyridinylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.