
CAS 1177277-04-1
:1-[1-(6,7,8,9-Tetrahydro-5H-1,2,4-triazolo[4,3-a]azepin-3-yl)ethyl]-1H-pyrazol-4-amine
Description:
1-[1-(6,7,8,9-Tetrahydro-5H-1,2,4-triazolo[4,3-a]azepin-3-yl)ethyl]-1H-pyrazol-4-amine is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a triazoloazepine moiety. This compound features a tetrahydrotriazole fused to an azepine, contributing to its unique pharmacological properties. It is typically classified as a heterocyclic organic compound, which often exhibits biological activity, making it of interest in medicinal chemistry. The presence of amine functional groups suggests potential for hydrogen bonding and reactivity, which can influence its solubility and interaction with biological targets. The compound's molecular structure may allow it to engage in various biochemical pathways, potentially serving as a lead compound for drug development. Its specific characteristics, such as melting point, solubility, and stability, would depend on the precise molecular interactions and the environment in which it is studied. Further research would be necessary to elucidate its full range of properties and potential applications in pharmaceuticals.
Formula:C12H18N6
InChI:InChI=1S/C12H18N6/c1-9(18-8-10(13)7-14-18)12-16-15-11-5-3-2-4-6-17(11)12/h7-9H,2-6,13H2,1H3
InChI key:InChIKey=UVUXAHFQLNZFFE-UHFFFAOYSA-N
SMILES:C(C)(C=1N2C(=NN1)CCCCC2)N3C=C(N)C=N3
Synonyms:- 1-[1-(6,7,8,9-Tetrahydro-5H-1,2,4-triazolo[4,3-a]azepin-3-yl)ethyl]-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 1-[1-(6,7,8,9-tetrahydro-5H-1,2,4-triazolo[4,3-a]azepin-3-yl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.