
CAS 1177277-28-9
:Benzeneethanol, β-amino-4-phenoxy-, ethanedioate (1:1)
Description:
Benzeneethanol, β-amino-4-phenoxy-, ethanedioate (1:1), identified by its CAS number 1177277-28-9, is a chemical compound characterized by its complex structure that includes a benzene ring, an amino group, and a phenoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, which may influence its solubility and reactivity. The presence of the β-amino group suggests potential for hydrogen bonding and interaction with biological systems, making it of interest in pharmaceutical applications. The ethanedioate component indicates the presence of a dicarboxylic acid moiety, which can contribute to the compound's acidity and potential for forming salts or esters. Overall, the unique combination of functional groups in this compound may impart specific biological activities, making it a candidate for further research in medicinal chemistry and related fields. However, detailed studies on its physical and chemical properties, as well as its biological activity, would be necessary to fully understand its potential applications.
Formula:C14H15NO2·C2H2O4
InChI:InChI=1S/C14H15NO2.C2H2O4/c15-14(10-16)11-6-8-13(9-7-11)17-12-4-2-1-3-5-12;3-1(4)2(5)6/h1-9,14,16H,10,15H2;(H,3,4)(H,5,6)
InChI key:InChIKey=TWOGNTWCZHLRRQ-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(CO)N)C=C1)C2=CC=CC=C2.C(C(O)=O)(O)=O
Synonyms:- Benzeneethanol, β-amino-4-phenoxy-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.