CymitQuimica logo

CAS 1177281-31-0

:

1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-amine

Description:
1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its unique structural features, including a pyrazole ring and a trifluoromethyl-substituted phenyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The pyrazole moiety is known for its diverse pharmacological properties, including anti-inflammatory and analgesic effects. This compound may exhibit specific reactivity due to the amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and solubility characteristics would be essential for its practical use in formulations. Overall, 1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-amine represents a class of compounds that could be explored for therapeutic applications, pending further investigation into its efficacy and safety profiles.
Formula:C11H10F3N3
InChI:InChI=1S/C11H10F3N3/c12-11(13,14)9-4-2-1-3-8(9)7-17-6-5-10(15)16-17/h1-6H,7H2,(H2,15,16)
InChI key:InChIKey=UBKGXDQDKOEEEL-UHFFFAOYSA-N
SMILES:C(C1=C(C(F)(F)F)C=CC=C1)N2C=CC(N)=N2
Synonyms:
  • 1H-Pyrazol-3-amine, 1-[[2-(trifluoromethyl)phenyl]methyl]-
  • 1-[[2-(Trifluoromethyl)phenyl]methyl]pyrazol-3-amine
  • 1-[[2-(Trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.