CAS 1177281-94-5

Piperidine, 2-(1-naphthalenylmethyl)-, ethanedioate (1:1)

Description:

Piperidine, 2-(1-naphthalenylmethyl)-, ethanedioate (1:1), with the CAS number 1177281-94-5, is a chemical compound that features a piperidine ring substituted with a naphthalenylmethyl group and is associated with ethanedioic acid (oxalic acid) in a 1:1 stoichiometry. This compound typically exhibits characteristics common to piperidine derivatives, such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is likely to be soluble in organic solvents due to the presence of the naphthalene moiety, which enhances its hydrophobic properties. The ethanedioate component suggests potential for forming salts or complexes, which may influence its reactivity and stability. Piperidine derivatives are often studied for their biological activity, and this compound may exhibit pharmacological properties, although specific biological data would need to be referenced for detailed insights. Overall, its unique structure combines features of both piperidine and naphthalene, potentially leading to interesting chemical behavior and applications in various fields, including medicinal chemistry.

Formula: C₁₆H₁₉N·C₂H₂O₄

InChI: InChI=1S/C16H19N.C2H2O4/c1-2-10-16-13(6-1)7-5-8-14(16)12-15-9-3-4-11-17-15;3-1(4)2(5)6/h1-2,5-8,10,15,17H,3-4,9,11-12H2;(H,3,4)(H,5,6)

InChI key: InChIKey=CIHRNCFEOKZCHO-UHFFFAOYSA-N

SMILES: C(C=1C2=C(C=CC1)C=CC=C2)C3CCCCN3.C(C(O)=O)(O)=O

Synonyms:

• Piperidine, 2-(1-naphthalenylmethyl)-, ethanedioate (1:1)