CAS 1177290-60-6

2-Pyrrolidinemethanamine, N-1-naphthalenyl-, ethanedioate (1:2)

Description:

2-Pyrrolidinemethanamine, N-1-naphthalenyl-, ethanedioate (1:2), with the CAS number 1177290-60-6, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a naphthalenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the ethanedioate moiety suggests that it may form salts or complexes, enhancing its stability and solubility in various solvents. Additionally, the naphthalene component may contribute to its aromatic characteristics, potentially affecting its electronic properties and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex structures. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₅H₁₈N₂·2C₂H₂O₄

InChI: InChI=1S/C15H18N2.C2H2O4/c1-2-8-14-12(5-1)6-3-9-15(14)17-11-13-7-4-10-16-13;3-1(4)2(5)6/h1-3,5-6,8-9,13,16-17H,4,7,10-11H2;(H,3,4)(H,5,6)

InChI key: InChIKey=ZQRNJAHVKOCEBG-UHFFFAOYSA-N

SMILES: N(CC1CCCN1)C=2C3=C(C=CC2)C=CC=C3.C(C(O)=O)(O)=O

Synonyms:

• 2-Pyrrolidinemethanamine, N-1-naphthalenyl-, ethanedioate (1:2)