CymitQuimica logo

CAS 1177292-32-8

:

N-Cyclopentyl-1,5-dimethyl-1H-pyrazole-4-methanamine

Description:
N-Cyclopentyl-1,5-dimethyl-1H-pyrazole-4-methanamine is a chemical compound characterized by its unique pyrazole structure, which includes a cyclopentyl group and two methyl groups at specific positions on the pyrazole ring. This compound typically exhibits properties associated with pyrazole derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the cyclopentyl group may influence its lipophilicity and interaction with biological targets. Additionally, the amine functional group suggests potential for hydrogen bonding, which can affect solubility and reactivity. The compound's molecular structure may confer specific pharmacological properties, making it a candidate for further research in drug development. Its CAS number, 1177292-32-8, allows for precise identification in chemical databases, facilitating studies related to its synthesis, characterization, and potential applications in various fields, including pharmaceuticals and agrochemicals. Overall, N-Cyclopentyl-1,5-dimethyl-1H-pyrazole-4-methanamine represents a class of compounds that may hold significant promise in therapeutic contexts.
Formula:C11H19N3
InChI:InChI=1S/C11H19N3/c1-9-10(8-13-14(9)2)7-12-11-5-3-4-6-11/h8,11-12H,3-7H2,1-2H3
InChI key:InChIKey=TYDRRDPSNMEMIP-UHFFFAOYSA-N
SMILES:C(NC1CCCC1)C2=C(C)N(C)N=C2
Synonyms:
  • N-Cyclopentyl-1,5-dimethyl-1H-pyrazole-4-methanamine
  • 1H-Pyrazole-4-methanamine, N-cyclopentyl-1,5-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.