CAS 1177292-42-0

4,5-Dichloro-β-ethyl-3-methyl-1H-pyrazole-1-ethanamine

Description:

4,5-Dichloro-β-ethyl-3-methyl-1H-pyrazole-1-ethanamine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of dichloro substituents at the 4 and 5 positions indicates that chlorine atoms are attached to the ring, influencing the compound's reactivity and potential biological activity. The β-ethyl and 3-methyl groups contribute to the compound's overall hydrophobic character, which can affect its solubility and interaction with biological systems. As an ethanamine derivative, it features an amine functional group that may participate in hydrogen bonding, enhancing its potential as a ligand in various chemical reactions. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.

Formula: C₈H₁₃Cl₂N₃

InChI: InChI=1S/C8H13Cl2N3/c1-3-6(4-11)13-8(10)7(9)5(2)12-13/h6H,3-4,11H2,1-2H3

InChI key: InChIKey=ACSLOOFGKJYNHL-UHFFFAOYSA-N

SMILES: C(CC)(CN)N1C(Cl)=C(Cl)C(C)=N1

Synonyms:

• 1H-Pyrazole-1-ethanamine, 4,5-dichloro-β-ethyl-3-methyl-
• 4,5-Dichloro-β-ethyl-3-methyl-1H-pyrazole-1-ethanamine