CAS 1177299-69-2

Phenol, 2-ethoxy-4-[(ethylamino)methyl]-, hydrochloride (1:1)

Description:

Phenol, 2-ethoxy-4-[(ethylamino)methyl]-, hydrochloride (1:1), with CAS number 1177299-69-2, is a chemical compound that features a phenolic structure substituted with an ethoxy group and an ethylamino group. This compound is typically characterized by its solubility in water due to the presence of the hydrochloride form, which enhances its ionic character. The ethoxy group contributes to its hydrophobic properties, while the ethylamino moiety can engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is likely to exhibit stability under various conditions, making it suitable for pharmaceutical applications. The compound may possess biological activity, potentially acting as a ligand or a precursor in synthetic pathways. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and the conditions under which it is studied. Safety data should be consulted for handling and usage, as phenolic compounds can be toxic and irritative.

Formula: C₁₁H₁₇NO₂·ClH

InChI: InChI=1S/C11H17NO2.ClH/c1-3-12-8-9-5-6-10(13)11(7-9)14-4-2;/h5-7,12-13H,3-4,8H2,1-2H3;1H

InChI key: InChIKey=NWOZDWFLGALKNW-UHFFFAOYSA-N

SMILES: O(CC)C1=CC(CNCC)=CC=C1O.Cl

Synonyms:

• Phenol, 2-ethoxy-4-[(ethylamino)methyl]-, hydrochloride (1:1)

2-Ethoxy-4-[(ethylamino)methyl]phenol hydrochloride

CAS: 1177299-69-2

Versatile small molecule scaffold

Formula: C₁₁H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 231.72 g/mol

Ref: 3D-CXB29969