CAS 117730-48-0

N-(4-hydroxyphenyl)-N-(1,1,1-trifluoro-2-propyl)-4-hydroxybenzamide

Description:

N-(4-hydroxyphenyl)-N-(1,1,1-trifluoro-2-propyl)-4-hydroxybenzamide, with CAS number 117730-48-0, is a chemical compound characterized by its unique structure that includes two hydroxyphenyl groups and a trifluoropropyl substituent. This compound is notable for its potential applications in pharmaceuticals and materials science due to the presence of the trifluoromethyl group, which can enhance lipophilicity and biological activity. The hydroxy groups contribute to its solubility in polar solvents and may also participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. The presence of fluorine atoms typically imparts unique electronic properties, which can affect the compound's stability and reactivity. Additionally, the amide functional group suggests potential for forming hydrogen bonds, which can be crucial in biological interactions. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and biological applications.

Formula: C₁₆H₁₄F₃NO₃

InChI: InChI=1/C16H14F3NO3/c1-10(16(17,18)19)20(12-4-8-14(22)9-5-12)15(23)11-2-6-13(21)7-3-11/h2-10,21-22H,1H3

SMILES: CC(C(F)(F)F)N(c1ccc(cc1)O)C(=O)c1ccc(cc1)O

Synonyms:

• Htph
• Benzamide, 4-hydroxy-N-(4-hydroxyphenyl)-N-(2,2,2-trifluoro-1-methylethyl)-
• 4-hydroxy-N-(4-hydroxyphenyl)-N-(2,2,2-trifluoro-1-methylethyl)benzamide
• N-(4-Hydroxyphenyl)-N-(1,1,1-trifluoro-2-propyl)-4-hydroxybenzamide