CAS 1177300-71-8

5-(4-Fluorophenyl)-1-methyl-1H-pyrazol-4-amine

Description:

5-(4-Fluorophenyl)-1-methyl-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring at the para position relative to the pyrazole structure. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its structural features. It may be soluble in organic solvents and exhibit moderate stability under standard conditions. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural attributes that could confer specific biological activities. As with many organic compounds, safety and handling precautions should be observed, as its toxicity and environmental impact would need to be assessed in practical applications.

Formula: C₁₀H₁₀FN₃

InChI: InChI=1S/C10H10FN3/c1-14-10(9(12)6-13-14)7-2-4-8(11)5-3-7/h2-6H,12H2,1H3

InChI key: InChIKey=OAYWLORICCXMBD-UHFFFAOYSA-N

SMILES: NC1=C(N(C)N=C1)C2=CC=C(F)C=C2

Synonyms:

• 5-(4-Fluorophenyl)-1-methyl-1H-pyrazol-4-amine
• 1H-Pyrazol-4-amine, 5-(4-fluorophenyl)-1-methyl-
• 4-Amino-5-(4-fluorophenyl)-1-methylpyrazole