CAS 1177306-14-7

1H-Azepine, 2-cyclobutylhexahydro-, ethanedioate (1:1)

Description:

1H-Azepine, 2-cyclobutylhexahydro-, ethanedioate (1:1), identified by its CAS number 1177306-14-7, is a chemical compound that features a bicyclic structure incorporating a seven-membered azepine ring and a cyclobutane moiety. This compound is characterized by its unique ring system, which contributes to its potential reactivity and stability. The presence of the ethanedioate moiety indicates that it may form salts or complexes, influencing its solubility and interaction with other substances. Typically, compounds of this nature may exhibit interesting biological activities or serve as intermediates in synthetic chemistry. The specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied. As with many organic compounds, safety data and handling precautions are essential, particularly if the compound exhibits any toxicological effects. Further research and characterization would be necessary to fully understand its applications and behavior in various chemical contexts.

Formula: C₁₀H₁₉N·C₂H₂O₄

InChI: InChI=1S/C10H19N.C2H2O4/c1-2-7-10(11-8-3-1)9-5-4-6-9;3-1(4)2(5)6/h9-11H,1-8H2;(H,3,4)(H,5,6)

InChI key: InChIKey=UGHFTYVWVMNGEB-UHFFFAOYSA-N

SMILES: C1(CCC1)C2CCCCCN2.C(C(O)=O)(O)=O

Synonyms:

• 1H-Azepine, 2-cyclobutylhexahydro-, ethanedioate (1:1)