
CAS 1177307-17-3
:Benzeneethanol, β-amino-4-(pentyloxy)-, ethanedioate (1:1)
Description:
Benzeneethanol, β-amino-4-(pentyloxy)-, ethanedioate (1:1), with CAS number 1177307-17-3, is a chemical compound characterized by its structural components, which include a benzene ring, an ethanol moiety, and an amino group. The presence of the pentyloxy group indicates a five-carbon alkoxy chain, contributing to its hydrophobic characteristics. The ethanedioate part suggests the presence of a dicarboxylic acid derivative, which can influence the compound's acidity and reactivity. This compound may exhibit properties typical of both aromatic and aliphatic compounds, potentially leading to interesting interactions in biological systems or materials science. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for various applications in organic synthesis, pharmaceuticals, or as a potential ligand in coordination chemistry. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.
Formula:C13H21NO2·C2H2O4
InChI:InChI=1S/C13H21NO2.C2H2O4/c1-2-3-4-9-16-12-7-5-11(6-8-12)13(14)10-15;3-1(4)2(5)6/h5-8,13,15H,2-4,9-10,14H2,1H3;(H,3,4)(H,5,6)
InChI key:InChIKey=DSVXESSNVQSCHJ-UHFFFAOYSA-N
SMILES:C(CO)(N)C1=CC=C(OCCCCC)C=C1.C(C(O)=O)(O)=O
Synonyms:- Benzeneethanol, β-amino-4-(pentyloxy)-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.