
CAS 1177307-49-1
:1-(2-Methoxyphenyl)-1H-pyrazole-4-methanamine
Description:
1-(2-Methoxyphenyl)-1H-pyrazole-4-methanamine, identified by its CAS number 1177307-49-1, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methoxyphenyl group, indicating the presence of a methoxy (-OCH3) substituent on a phenyl ring, which can influence its solubility and reactivity. The methanamine functional group suggests the presence of an amine (-NH2) attached to the pyrazole ring, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The structural arrangement of this compound may impart specific biological activities, making it of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Overall, this compound's unique structure may contribute to its potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its chemical behavior and biological effects.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c1-15-11-5-3-2-4-10(11)14-8-9(6-12)7-13-14/h2-5,7-8H,6,12H2,1H3
InChI key:InChIKey=AXLPIIREAODDKW-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)N2C=C(CN)C=N2
Synonyms:- 1-(2-Methoxyphenyl)-1H-pyrazole-4-methanamine
- 1H-Pyrazole-4-methanamine, 1-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.