
CAS 1177312-52-5
:1-[(4-Nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid
Description:
1-[(4-Nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a nitro group at the 4-position of the pyrazole ring contributes to its electron-withdrawing properties, potentially influencing its reactivity and biological activity. The compound features a carboxylic acid functional group at the 3-position, which can participate in hydrogen bonding and may enhance its solubility in polar solvents. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the nitro and carboxylic acid functionalities, which can be involved in various chemical interactions. Additionally, the compound's unique structural features may allow for specific interactions with biological targets, making it a candidate for further investigation in drug discovery and development. Overall, its characteristics indicate a compound of interest in both synthetic and applied chemistry contexts.
Formula:C8H7N5O4
InChI:InChI=1S/C8H7N5O4/c14-8(15)7-1-2-11(10-7)5-12-4-6(3-9-12)13(16)17/h1-4H,5H2,(H,14,15)
InChI key:InChIKey=FAZBOHQULMQUDK-UHFFFAOYSA-N
SMILES:C(N1C=C(N(=O)=O)C=N1)N2N=C(C(O)=O)C=C2
Synonyms:- 1-[(4-Nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid
- 1H-Pyrazole-3-carboxylic acid, 1-[(4-nitro-1H-pyrazol-1-yl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.