CAS 1177320-89-6

3-Methyl-4-nitro-1H-pyrazole-1-acetamide

Description:

3-Methyl-4-nitro-1H-pyrazole-1-acetamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a methyl group at the 3-position and a nitro group at the 4-position contributes to its unique reactivity and properties. The acetamide functional group enhances its solubility in polar solvents and may influence its biological activity. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential applications in drug design and synthesis. Its molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest for further investigation. Additionally, the compound's stability, melting point, and solubility characteristics can vary based on environmental conditions and the presence of other substances. As with many chemical compounds, safety data sheets should be consulted for handling and toxicity information.

Formula: C₆H₈N₄O₃

InChI: InChI=1S/C6H8N4O3/c1-4-5(10(12)13)2-9(8-4)3-6(7)11/h2H,3H2,1H3,(H2,7,11)

InChI key: InChIKey=DSWGEJRUFDSNCT-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CN(CC(N)=O)N=C1C

Synonyms:

• 3-Methyl-4-nitro-1H-pyrazole-1-acetamide
• 1H-Pyrazole-1-acetamide, 3-methyl-4-nitro-