CAS 1177331-23-5

2-Pyrrolidinemethanamine, N-(2-chlorophenyl)-, ethanedioate (1:2)

Description:

2-Pyrrolidinemethanamine, N-(2-chlorophenyl)-, ethanedioate (1:2) is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a chlorophenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the ethanedioate moiety suggests that it may form salts, enhancing its stability and solubility in various solvents. The chlorophenyl substituent can impart specific electronic properties, potentially affecting the compound's biological activity and interaction with other molecules. This compound may be of interest in pharmaceutical research due to its structural features, which could contribute to its efficacy in biological systems. Additionally, its CAS number, 1177331-23-5, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₁H₁₅ClN₂·2C₂H₂O₄

InChI: InChI=1S/C11H15ClN2.C2H2O4/c12-10-5-1-2-6-11(10)14-8-9-4-3-7-13-9;3-1(4)2(5)6/h1-2,5-6,9,13-14H,3-4,7-8H2;(H,3,4)(H,5,6)

InChI key: InChIKey=GVKLTRMCQRUMQK-UHFFFAOYSA-N

SMILES: N(CC1CCCN1)C2=C(Cl)C=CC=C2.C(C(O)=O)(O)=O

Synonyms:

• 2-Pyrrolidinemethanamine, N-(2-chlorophenyl)-, ethanedioate (1:2)