
CAS 1177345-96-8
:2-Pyrrolidinone, 4-amino-1-(4-chlorophenyl)-, hydrochloride (1:1)
Description:
2-Pyrrolidinone, 4-amino-1-(4-chlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidinone core, which is a five-membered lactam ring. The presence of an amino group and a 4-chlorophenyl substituent indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride salt form suggests that it is a stable, water-soluble compound, which is often advantageous for biological activity and formulation. This compound may exhibit properties such as being a potential inhibitor or modulator in various biochemical pathways, although specific biological activities would depend on further empirical studies. Its molecular structure contributes to its reactivity and interaction with biological targets, making it of interest in drug discovery and development. As with many chemical substances, safety data and handling precautions are essential, particularly due to the presence of the chlorophenyl group, which may pose environmental and health risks.
Formula:C10H11ClN2O·ClH
InChI:InChI=1S/C10H11ClN2O.ClH/c11-7-1-3-9(4-2-7)13-6-8(12)5-10(13)14;/h1-4,8H,5-6,12H2;1H
InChI key:InChIKey=IVCPWUZGCDFDMO-UHFFFAOYSA-N
SMILES:O=C1N(CC(N)C1)C2=CC=C(Cl)C=C2.Cl
Synonyms:- 2-Pyrrolidinone, 4-amino-1-(4-chlorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.