
CAS 1177346-50-7
:1H-Imidazol-2-amine, 5-(4-bromophenyl)-, sulfate (1:1)
Description:
1H-Imidazol-2-amine, 5-(4-bromophenyl)-, sulfate (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of the 4-bromophenyl group indicates that there is a bromine substituent on a phenyl ring, contributing to the compound's potential biological activity and reactivity. The sulfate component suggests that the compound is a salt, which can influence its solubility and stability in various solvents. This compound may exhibit properties typical of imidazole derivatives, such as acting as a ligand in coordination chemistry or displaying pharmacological activities. Its specific applications and behavior would depend on the context of its use, including potential roles in medicinal chemistry or as a research reagent. As with many organic compounds, safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C9H8BrN3·H2O4S
InChI:InChI=1S/C9H8BrN3.H2O4S/c10-7-3-1-6(2-4-7)8-5-12-9(11)13-8;1-5(2,3)4/h1-5H,(H3,11,12,13);(H2,1,2,3,4)
InChI key:InChIKey=YCLUTOYTUOKYQM-UHFFFAOYSA-N
SMILES:NC=1NC(C2=CC=C(Br)C=C2)=CN1.S(=O)(=O)(O)O
Synonyms:- 1H-Imidazol-2-amine, 5-(4-bromophenyl)-, sulfate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.