CAS 1177347-49-7

2-Pyrrolidinemethanamine, N-2-naphthalenyl-, ethanedioate (1:2)

Description:

2-Pyrrolidinemethanamine, N-2-naphthalenyl-, ethanedioate (1:2), also known by its CAS number 1177347-49-7, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a naphthalene moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the ethanedioate (oxalate) component suggests that it may form salts or complexes, enhancing its potential applications in various fields, including pharmaceuticals and materials science. The naphthalene group may impart aromatic characteristics, contributing to the compound's stability and potential interactions with other molecules. Additionally, the compound's molecular structure may allow for specific biological activities, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₅H₁₈N₂·2C₂H₂O₄

InChI: InChI=1S/C15H18N2.C2H2O4/c1-2-5-13-10-14(8-7-12(13)4-1)17-11-15-6-3-9-16-15;3-1(4)2(5)6/h1-2,4-5,7-8,10,15-17H,3,6,9,11H2;(H,3,4)(H,5,6)

InChI key: InChIKey=NCVASVRGDDWGRS-UHFFFAOYSA-N

SMILES: N(CC1CCCN1)C2=CC3=C(C=C2)C=CC=C3.C(C(O)=O)(O)=O

Synonyms:

• 2-Pyrrolidinemethanamine, N-2-naphthalenyl-, ethanedioate (1:2)