CAS 1177347-82-8
:5-Methyl-1-propyl-1H-pyrazole-4-carbonitrile
Description:
5-Methyl-1-propyl-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a methyl group and a propyl group on the pyrazole ring contributes to its unique properties and reactivity. The carbonitrile functional group (-C≡N) at the 4-position enhances its polarity and can influence its solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as a building block in organic synthesis. The compound's stability, reactivity, and interactions with other substances can vary based on environmental conditions such as temperature and pH. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 5-Methyl-1-propyl-1H-pyrazole-4-carbonitrile represents a class of compounds that can be explored for various chemical and biological applications.
Formula:C8H11N3
InChI:InChI=1S/C8H11N3/c1-3-4-11-7(2)8(5-9)6-10-11/h6H,3-4H2,1-2H3
InChI key:InChIKey=GDKFXUIDXJBRGN-UHFFFAOYSA-N
SMILES:C(CC)N1C(C)=C(C#N)C=N1
Synonyms:- 5-Methyl-1-propyl-1H-pyrazole-4-carbonitrile
- 1H-Pyrazole-4-carbonitrile, 5-methyl-1-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.