CAS 1177348-10-5: 5-[4-(Ethylsulfonyl)phenyl]-1,3,4-oxadiazol-2-amine

Description: 5-[4-(Ethylsulfonyl)phenyl]-1,3,4-oxadiazol-2-amine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the ethylsulfonyl group enhances its solubility and reactivity, making it a candidate for various applications in medicinal chemistry. This compound typically exhibits properties such as moderate to high stability under standard conditions, and its functional groups may impart specific interactions with biological targets, potentially influencing its pharmacological profile. The oxadiazole moiety is often associated with antimicrobial and anti-inflammatory activities, suggesting that this compound may have therapeutic potential. Additionally, the compound's molecular structure allows for various synthetic modifications, which can be explored to optimize its efficacy and selectivity. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need thorough investigation in preclinical studies. Overall, 5-[4-(Ethylsulfonyl)phenyl]-1,3,4-oxadiazol-2-amine represents a promising scaffold for further research in drug development.

Formula: C₁₀H₁₁N₃O₃S

InChI: InChI=1S/C10H11N3O3S/c1-2-17(14,15)8-5-3-7(4-6-8)9-12-13-10(11)16-9/h3-6H,2H2,1H3,(H2,11,13)

InChI key: InChIKey=BCMIXGGLRCZSAA-UHFFFAOYSA-N

SMILES: O=S(=O)(C=1C=CC(=CC1)C2=NN=C(O2)N)CC

Synonyms:

• 5-[4-(Ethylsulfonyl)phenyl]-1,3,4-oxadiazol-2-amine
• 1,3,4-Oxadiazol-2-amine, 5-[4-(ethylsulfonyl)phenyl]-

5-[4-(ethylsulfonyl)phenyl]-1,3,4-oxadiazol-2-amine

CAS: 1177348-10-5

• Purity: 95.0%
• Molecular weight: 253.27999877929688

5-[4-(Ethanesulfonyl)phenyl]-1,3,4-oxadiazol-2-amine

CAS: 1177348-10-5

Versatile small molecule scaffold

• Formula: C₁₀H₁₁N₃O₃S
• Purity: Min. 95%
• Molecular weight: 253.28 g/mol