CymitQuimica logo

CAS 1177348-33-2

:

3-Pyrrolidinemethanamine, 1-(2-furanylmethyl)-, ethanedioate (1:1)

Description:
3-Pyrrolidinemethanamine, 1-(2-furanylmethyl)-, ethanedioate (1:1), with the CAS number 1177348-33-2, is a chemical compound characterized by its unique structural features. It consists of a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a furan moiety, indicating the presence of an aromatic ring with an oxygen atom. The ethanedioate component suggests that the compound forms a salt or complex with oxalic acid, contributing to its stability and solubility in various solvents. This compound may exhibit biological activity due to the presence of the amine functional group, which can participate in hydrogen bonding and interact with biological targets. Its potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity. However, detailed studies would be necessary to fully understand its behavior, including its solubility, melting point, and reactivity with other substances. Safety and handling precautions should be observed, as with any chemical compound, particularly those with biological activity.
Formula:C10H16N2O·C2H2O4
InChI:InChI=1S/C10H16N2O.C2H2O4/c11-6-9-3-4-12(7-9)8-10-2-1-5-13-10;3-1(4)2(5)6/h1-2,5,9H,3-4,6-8,11H2;(H,3,4)(H,5,6)
InChI key:InChIKey=GAKYICOMXVZJPH-UHFFFAOYSA-N
SMILES:C(N1CC(CN)CC1)C2=CC=CO2.C(C(O)=O)(O)=O
Synonyms:
  • 3-Pyrrolidinemethanamine, 1-(2-furanylmethyl)-, ethanedioate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.