CAS 1177348-57-0

5(2H)-Isoxazolone, 4-(3-aminopropyl)-3-(4-pyridinyl)-, hydrochloride (1:1)

Description:

5(2H)-Isoxazolone, 4-(3-aminopropyl)-3-(4-pyridinyl)-, hydrochloride (1:1), with CAS number 1177348-57-0, is a chemical compound characterized by its isoxazolone core structure, which is a five-membered heterocyclic ring containing both nitrogen and oxygen. This compound features a 4-(3-aminopropyl) substituent, indicating the presence of an amino group attached to a propyl chain, which contributes to its potential biological activity. The 3-(4-pyridinyl) group suggests the presence of a pyridine ring, which is known for its aromatic properties and ability to participate in various chemical interactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise conditions and formulation used.

Formula: C₁₁H₁₃N₃O₂·ClH

InChI: InChI=1S/C11H13N3O2.ClH/c12-5-1-2-9-10(14-16-11(9)15)8-3-6-13-7-4-8;/h3-4,6-7,14H,1-2,5,12H2;1H

InChI key: InChIKey=ACANYPIFDCSSEH-UHFFFAOYSA-N

SMILES: C(CCN)C1=C(NOC1=O)C=2C=CN=CC2.Cl

Synonyms:

• 5(2H)-Isoxazolone, 4-(3-aminopropyl)-3-(4-pyridinyl)-, hydrochloride (1:1)