CAS 1177350-52-5

Piperidine, 2-cyclopentyl-, hydrochloride (1:1)

Description:

Piperidine, 2-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a cyclopentyl group at the second position of the piperidine ring contributes to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to form salts with acids. Its potential applications could span various fields, including medicinal chemistry, where it may serve as a building block for pharmaceuticals or as a ligand in coordination chemistry. The specific interactions and reactivity of this compound can be influenced by the cyclopentyl substituent, which may affect its steric and electronic characteristics. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₉N·ClH

InChI: InChI=1S/C10H19N.ClH/c1-2-6-9(5-1)10-7-3-4-8-11-10;/h9-11H,1-8H2;1H

InChI key: InChIKey=BMHKGOHPFAHDRL-UHFFFAOYSA-N

SMILES: C1(CCCC1)C2CCCCN2.Cl

Synonyms:

• Piperidine, 2-cyclopentyl-, hydrochloride (1:1)
• 2-Cyclopentylpiperidine hydrochloride

2-Cyclopentylpiperidine hydrochloride

CAS: 1177350-52-5

2-Cyclopentylpiperidine hydrochloride

Purity: 95%

Molecular weight: 189.73g/mol

Ref: 54-OR905476