CAS 1177355-20-2
:1-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]cyclopropanemethanamine
Description:
1-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]cyclopropanemethanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyrazole moiety. The presence of the 3,5-dimethyl substituents on the pyrazole ring contributes to its stability and potential biological activity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The cyclopropane structure may impart strain, affecting the compound's overall reactivity and interaction with other molecules. Additionally, the pyrazole ring is known for its pharmacological significance, often being associated with various biological activities, including anti-inflammatory and analgesic effects. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and drug development.
Formula:C10H17N3
InChI:InChI=1S/C10H17N3/c1-8-5-9(2)13(12-8)7-10(6-11)3-4-10/h5H,3-4,6-7,11H2,1-2H3
InChI key:InChIKey=DNMCNCNPTCWTJX-UHFFFAOYSA-N
SMILES:C(C1(CN)CC1)N2N=C(C)C=C2C
Synonyms:- [1-[(3,5-Dimethylpyrazol-1-yl)methyl]cyclopropyl]methanamine
- ((1-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]cyclopropyl)methyl)amine
- Cyclopropanemethanamine, 1-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-
- 1-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]cyclopropanemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.