CAS 1177355-64-4
:3,5-Dimethyl-1-(2-pyridinyl)-1H-pyrazole-4-ethanamine
Description:
3,5-Dimethyl-1-(2-pyridinyl)-1H-pyrazole-4-ethanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with methyl groups and a pyridine moiety. This compound features a 1H-pyrazole core, which is a five-membered ring containing two nitrogen atoms, contributing to its potential biological activity. The presence of the 2-pyridinyl group enhances its lipophilicity and may influence its interaction with biological targets. The ethylamine side chain adds to its basicity and can participate in hydrogen bonding, which is crucial for its solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3,5-Dimethyl-1-(2-pyridinyl)-1H-pyrazole-4-ethanamine represents a versatile scaffold for further research and development in chemical and pharmaceutical sciences.
Formula:C12H16N4
InChI:InChI=1S/C12H16N4/c1-9-11(6-7-13)10(2)16(15-9)12-5-3-4-8-14-12/h3-5,8H,6-7,13H2,1-2H3
InChI key:InChIKey=CYTTYUOWSNHCFY-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1CCN)C2=CC=CC=N2
Synonyms:- 1H-Pyrazole-4-ethanamine, 3,5-dimethyl-1-(2-pyridinyl)-
- 3,5-Dimethyl-1-(2-pyridinyl)-1H-pyrazole-4-ethanamine
- 2-[3,5-dimethyl-1-(2-pyridyl)pyrazol-4-yl]ethanamine
- 2-(3,5-dimethyl-1-(pyridin-2-yl)-1H-pyrazol-4-yl)ethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.