CAS 1177361-39-5

Piperidine, 2-(2,4-dichlorophenyl)-, hydrochloride (1:1)

Description:

Piperidine, 2-(2,4-dichlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 2-(2,4-dichlorophenyl) substituent indicates that the compound has a dichlorophenyl group attached to the piperidine at the second position, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, and the dichlorophenyl moiety may influence its lipophilicity and reactivity. Safety data should be consulted for handling, as compounds with halogenated aromatic groups can pose environmental and health risks. Overall, this substance is significant in the context of medicinal chemistry and may serve as a lead compound for further development.

Formula: C₁₁H₁₃Cl₂N·ClH

InChI: InChI=1S/C11H13Cl2N.ClH/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h4-5,7,11,14H,1-3,6H2;1H

InChI key: InChIKey=XPYYXLZTNCHKEL-UHFFFAOYSA-N

SMILES: ClC1=C(C2CCCCN2)C=CC(Cl)=C1.Cl

Synonyms:

• Piperidine, 2-(2,4-dichlorophenyl)-, hydrochloride (1:1)