CAS 1177362-25-2
:N,1-Bis(1-methylethyl)-1H-imidazol-2-amine
Description:
N,1-Bis(1-methylethyl)-1H-imidazol-2-amine, identified by its CAS number 1177362-25-2, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two isopropyl groups (1-methylethyl) attached to the nitrogen atom at the 1-position of the imidazole ring, contributing to its steric bulk and potentially influencing its reactivity and solubility. The presence of an amino group at the 2-position enhances its basicity and may facilitate interactions with various biological targets or chemical reagents. Typically, compounds of this nature may exhibit properties such as moderate to high solubility in organic solvents, and they may participate in hydrogen bonding due to the amino group. The specific applications and behavior of N,1-Bis(1-methylethyl)-1H-imidazol-2-amine would depend on its molecular interactions, making it of interest in fields such as medicinal chemistry or materials science.
Formula:C9H17N3
InChI:InChI=1S/C9H17N3/c1-7(2)11-9-10-5-6-12(9)8(3)4/h5-8H,1-4H3,(H,10,11)
InChI key:InChIKey=GJSNQPLZZPGWIS-UHFFFAOYSA-N
SMILES:N(C(C)C)C=1N(C(C)C)C=CN1
Synonyms:- N,1-Bis(1-methylethyl)-1H-imidazol-2-amine
- 1H-Imidazol-2-amine, N,1-bis(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.