CAS 117737-43-6

[(2-nitrophenyl)sulfinyl]acetic acid

Description:

[(2-Nitrophenyl)sulfinyl]acetic acid is an organic compound characterized by the presence of a sulfinyl group (-S=O) attached to a 2-nitrophenyl moiety and an acetic acid functional group. This compound typically exhibits a yellowish color due to the nitro group, which can influence its reactivity and solubility. The sulfinyl group introduces unique properties, such as potential for oxidation and coordination with metal ions, making it of interest in various chemical reactions. The presence of the carboxylic acid group (-COOH) contributes to its acidity and ability to form salts or esters. This compound may also exhibit biological activity, which can be explored in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₈H₇NO₅S

InChI: InChI=1/C8H7NO5S/c10-8(11)5-15(14)7-4-2-1-3-6(7)9(12)13/h1-4H,5H2,(H,10,11)

SMILES: c1ccc(c(c1)N(=O)=O)S(=O)CC(=O)O

Synonyms:

• Acetic Acid, 2-[(2-Nitrophenyl)Sulfinyl]-

[(2-nitrophenyl)sulfinyl]acetic acid

CAS: 117737-43-6

Formula: C₈H₇NO₅S

Purity: 95.0%

Molecular weight: 229.21

Ref: 10-F315189

[(2-Nitrophenyl)sulfinyl]acetic acid

CAS: 117737-43-6

[(2-Nitrophenyl)sulfinyl]acetic acid is a white powder that has a molecular weight of 214.2 and is soluble in water. It reacts with hydrogen to form nitrosyl, which is an electron acceptor. It also has the ability to stabilize hydrogen bonds.

Formula: C₈H₇NO₅S

Purity: Min. 95%

Molecular weight: 229.21 g/mol

Ref: 3D-SEA73743