CAS 1177415-98-3
:8-Bromo-6-chloro-N-(3-fluoro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide
Description:
8-Bromo-6-chloro-N-(3-fluoro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide is a synthetic organic compound characterized by its complex heterocyclic structure, which includes imidazo and pyridazine rings. This compound features multiple halogen substituents, specifically bromine and chlorine, which can influence its reactivity and biological activity. The presence of a fluorinated pyridine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as fluorine can enhance metabolic stability and lipophilicity. The carboxamide functional group contributes to its solubility and potential interactions with biological targets. This compound may exhibit specific pharmacological properties, making it of interest in drug discovery and development. Its unique structural features and substituents can also affect its physical properties, such as melting point, solubility, and spectral characteristics. As with many compounds in this class, further studies would be necessary to elucidate its full biological profile and potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C12H6BrClFN5O
InChI:InChI=1S/C12H6BrClFN5O/c13-6-3-10(14)19-20-9(5-17-11(6)20)12(21)18-8-1-2-16-4-7(8)15/h1-5H,(H,16,18,21)
InChI key:InChIKey=YZKZHTHBVCOZMF-UHFFFAOYSA-N
SMILES:C(NC=1C(F)=CN=CC1)(=O)C=2N3C(=NC2)C(Br)=CC(Cl)=N3
Synonyms:- 8-Bromo-6-chloro-N-(3-fluoro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide
- Imidazo[1,2-b]pyridazine-3-carboxamide, 8-bromo-6-chloro-N-(3-fluoro-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Bromo-6-chloro-N-(3-fluoropyridin-4-yl)imidazo[1,2-b]pyridazine-3-carboxamide
CAS:Formula:C12H6BrClFN5OMolecular weight:370.5643
