CAS 1177416-22-6
:8-Bromo-6-chloro-N-(2-chloro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide
Description:
8-Bromo-6-chloro-N-(2-chloro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide is a chemical compound characterized by its complex heterocyclic structure, which includes imidazo and pyridazine rings. This compound features multiple halogen substituents, specifically bromine and chlorine, which can influence its reactivity and biological activity. The presence of a carboxamide functional group suggests potential for hydrogen bonding, making it a candidate for interactions with biological targets. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their anticancer and antimicrobial properties. The specific arrangement of the chlorine and bromine atoms, along with the pyridine moiety, may contribute to its pharmacological profile. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular geometry, making it a subject of interest for further research in drug design and synthesis.
Formula:C12H6BrCl2N5O
InChI:InChI=1S/C12H6BrCl2N5O/c13-7-4-10(15)19-20-8(5-17-11(7)20)12(21)18-6-1-2-16-9(14)3-6/h1-5H,(H,16,18,21)
InChI key:InChIKey=KZTNVDJWXYFIJB-UHFFFAOYSA-N
SMILES:C(NC=1C=C(Cl)N=CC1)(=O)C=2N3C(=NC2)C(Br)=CC(Cl)=N3
Synonyms:- Imidazo[1,2-b]pyridazine-3-carboxamide, 8-bromo-6-chloro-N-(2-chloro-4-pyridinyl)-
- 8-Bromo-6-chloro-N-(2-chloro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Bromo-6-chloro-N-(2-chloropyridin-4-yl)imidazo[1,2-b]pyridazine-3-carboxamide
CAS:Formula:C12H6BrCl2N5OMolecular weight:387.0189
