
CAS 1177423-62-9
:5-Amino-N-ethyl-1,3,4-thiadiazole-2-carboxamide
Description:
5-Amino-N-ethyl-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an amino group, and a carboxamide functional group. This compound is typically classified as a heterocyclic organic molecule due to the presence of nitrogen and sulfur in its ring structure. The amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, while the carboxamide enhances its solubility and reactivity. The ethyl substituent on the nitrogen atom can influence the compound's biological activity and lipophilicity. In terms of physical properties, compounds of this nature often exhibit moderate to high melting points and solubility in polar solvents. The presence of multiple functional groups suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 5-Amino-N-ethyl-1,3,4-thiadiazole-2-carboxamide is of interest in medicinal chemistry and material science due to its diverse reactivity and potential applications.
Formula:C5H8N4OS
InChI:InChI=1S/C5H8N4OS/c1-2-7-3(10)4-8-9-5(6)11-4/h2H2,1H3,(H2,6,9)(H,7,10)
InChI key:InChIKey=SAECLZGRTIAQET-UHFFFAOYSA-N
SMILES:C(NCC)(=O)C1=NN=C(N)S1
Synonyms:- 5-Amino-N-ethyl-1,3,4-thiadiazole-2-carboxamide
- 1,3,4-Thiadiazole-2-carboxamide, 5-amino-N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.