CAS 117752-04-2
:2-Fluoro-6-methylbenzaldehyde
Description:
2-Fluoro-6-methylbenzaldehyde is an aromatic aldehyde characterized by the presence of a fluorine atom and a methyl group on a benzene ring, specifically at the 2 and 6 positions, respectively. This compound features a formyl group (-CHO) that is responsible for its aldehyde properties, contributing to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom can influence the electronic properties of the molecule, often enhancing its reactivity in nucleophilic substitution reactions. Additionally, the methyl group can affect the steric hindrance and overall stability of the compound. 2-Fluoro-6-methylbenzaldehyde is typically a colorless to pale yellow liquid with a distinct aromatic odor. It is soluble in organic solvents and may exhibit moderate solubility in water. This compound can be utilized in various chemical reactions, including the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, making it a valuable intermediate in organic chemistry. Safety precautions should be taken when handling this substance due to its potential irritant properties.
Formula:C8H7FO
InChI:InChI=1/C8H7FO/c1-6-3-2-4-8(9)7(6)5-10/h2-5H,1H3
SMILES:Cc1cccc(c1C=O)F
Synonyms:- Benzaldehyde, 2-Fluoro-6-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-6-methylbenzaldehyde, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H7FOPurity:97%Molecular weight:138.142-Fluoro-6-methylbenzaldehyde
CAS:Formula:C8H7FOPurity:96%Color and Shape:LiquidMolecular weight:138.13902-Fluoro-6-methylbenzaldehyde
CAS:2-Fluoro-6-methylbenzaldehydeFormula:C8H7FOPurity:95%Color and Shape: clear. faint yellow liquidMolecular weight:138.14g/mol2-Fluoro-6-methylbenzaldehyde
CAS:Formula:C8H7FOPurity:95%Color and Shape:LiquidMolecular weight:138.141



